C11H16O5S — CID 117404933
1-(2,5-dimethoxy-3-methylsulfonylphenyl)ethanol (PubChem CID 117404933) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-3-methylsulfonylphenyl)ethanol.
| Compound Name | 1-(2,5-dimethoxy-3-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 117404933 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1-(2,5-dimethoxy-3-methylsulfonylphenyl)ethanol |
| SMILES | COc1cc(C(C)O)c(OC)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H16O5S/c1-7(12)9-5-8(15-2)6-10(11(9)16-3)17(4,13)14/h5-7,12H,1-4H3 |
| InChIKey | XLGKVFORAGGLEU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |