C11H16FNO4S — CID 117444120
1-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-2-(methylamino)ethanol (PubChem CID 117444120) has the molecular formula C11H16FNO4S and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-2-(methylamino)ethanol.
| Compound Name | 1-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117444120 |
| Molecular Formula | C11H16FNO4S |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-(5-fluoro-2-methoxy-3-methylsulfonylphenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1cc(F)cc(S(C)(=O)=O)c1OC |
| InChI | InChI=1S/C11H16FNO4S/c1-13-6-9(14)8-4-7(12)5-10(11(8)17-2)18(3,15)16/h4-5,9,13-14H,6H2,1-3H3 |
| InChIKey | JMTVJKDYKVCVAE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |