C12H15ClFNO2 — CID 117403462
1-(3-chloro-2-cyclopropyloxy-5-fluorophenyl)-2-(methylamino)ethanol (PubChem CID 117403462) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 1-(3-chloro-2-cyclopropyloxy-5-fluorophenyl)-2-(methylamino)ethanol.
| Compound Name | 1-(3-chloro-2-cyclopropyloxy-5-fluorophenyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117403462 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(3-chloro-2-cyclopropyloxy-5-fluorophenyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1cc(F)cc(Cl)c1OC1CC1 |
| InChI | InChI=1S/C12H15ClFNO2/c1-15-6-11(16)9-4-7(14)5-10(13)12(9)17-8-2-3-8/h4-5,8,11,15-16H,2-3,6H2,1H3 |
| InChIKey | QSFGNGXJTKEMKI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |