2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid

C12H16O6S — CID 117465732

IUPAC2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(OC)c(S(C)(=O)=O)c1
InChIInChI=1S/C12H16O6S/c1-7(12(13)14)9-5-8(17-2)6-10(11(9)18-3)19(4,15)16/h5-7H,1-4H3,(H,13,14)
InChIKeyLGFMAALVXFZLLA-UHFFFAOYSA-N
MW288.32 g/mol
LogP1.30
Rot. Bonds5

About 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid

2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid (PubChem CID 117465732) has the molecular formula C12H16O6S and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid.

Molecular Properties

Compound Name2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid
PubChem CID117465732
Molecular FormulaC12H16O6S
Molecular Weight288.32 g/mol
Exact Mass288.07
IUPAC Name2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid
SMILESCOc1cc(C(C)C(=O)O)c(OC)c(S(C)(=O)=O)c1
InChIInChI=1S/C12H16O6S/c1-7(12(13)14)9-5-8(17-2)6-10(11(9)18-3)19(4,15)16/h5-7H,1-4H3,(H,13,14)
InChIKeyLGFMAALVXFZLLA-UHFFFAOYSA-N
XLogP1.30
TPSA89.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.32
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid?
The IUPAC name of 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid (CID 117465732) is 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid.
What is the SMILES notation for 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid?
The canonical SMILES for 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid is COc1cc(C(C)C(=O)O)c(OC)c(S(C)(=O)=O)c1.
What is the InChIKey of 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid?
The InChIKey is LGFMAALVXFZLLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O6S/c1-7(12(13)14)9-5-8(17-2)6-10(11(9)18-3)19(4,15)16/h5-7H,1-4H3,(H,13,14).
What are the key properties of 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid?
2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid has a molecular weight of 288.32 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxy-3-methylsulfonylphenyl)propanoic acid is sourced from PubChem (CID 117465732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).