C10H12FNO5S — CID 117443870
3-amino-3-(5-fluoro-2-hydroxy-4-methylsulfonylphenyl)propanoic acid (PubChem CID 117443870) has the molecular formula C10H12FNO5S and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-amino-3-(5-fluoro-2-hydroxy-4-methylsulfonylphenyl)propanoic acid.
| Compound Name | 3-amino-3-(5-fluoro-2-hydroxy-4-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117443870 |
| Molecular Formula | C10H12FNO5S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-amino-3-(5-fluoro-2-hydroxy-4-methylsulfonylphenyl)propanoic acid |
| SMILES | CS(=O)(=O)c1cc(O)c(C(N)CC(=O)O)cc1F |
| InChI | InChI=1S/C10H12FNO5S/c1-18(16,17)9-4-8(13)5(2-6(9)11)7(12)3-10(14)15/h2,4,7,13H,3,12H2,1H3,(H,14,15) |
| InChIKey | BBUAKVAXELDBFF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|