C9H11ClFNO3 — CID 162344213
(3S)-3-amino-3-(5-fluoro-2-hydroxyphenyl)propanoic acid;hydrochloride (PubChem CID 162344213) has the molecular formula C9H11ClFNO3 and a molecular weight of 235.64 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-fluoro-2-hydroxyphenyl)propanoic acid;hydrochloride.
| Compound Name | (3S)-3-amino-3-(5-fluoro-2-hydroxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 162344213 |
| Molecular Formula | C9H11ClFNO3 |
| Molecular Weight | 235.64 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (3S)-3-amino-3-(5-fluoro-2-hydroxyphenyl)propanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)O)c1cc(F)ccc1O |
| InChI | InChI=1S/C9H10FNO3.ClH/c10-5-1-2-8(12)6(3-5)7(11)4-9(13)14;/h1-3,7,12H,4,11H2,(H,13,14);1H/t7-;/m0./s1 |
| InChIKey | VCLORIBBXDPQBL-FJXQXJEOSA-N |
| XLogP | 1.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|