C11H11NO4 — CID 171026875
2-(2-cyano-4-methoxy-6-methylphenyl)-2-hydroxyacetic acid (PubChem CID 171026875) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(2-cyano-4-methoxy-6-methylphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2-cyano-4-methoxy-6-methylphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 171026875 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(2-cyano-4-methoxy-6-methylphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(C)c(C(O)C(=O)O)c(C#N)c1 |
| InChI | InChI=1S/C11H11NO4/c1-6-3-8(16-2)4-7(5-12)9(6)10(13)11(14)15/h3-4,10,13H,1-2H3,(H,14,15) |
| InChIKey | ZGUBKFHSOIWFCS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |