C13H15NO3 — CID 42638797
2-(2,4-dimethoxy-6-methylphenyl)-3-oxobutanenitrile (PubChem CID 42638797) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-6-methylphenyl)-3-oxobutanenitrile.
| Compound Name | 2-(2,4-dimethoxy-6-methylphenyl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 42638797 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-(2,4-dimethoxy-6-methylphenyl)-3-oxobutanenitrile |
| SMILES | COc1cc(C)c(C(C#N)C(C)=O)c(OC)c1 |
| InChI | InChI=1S/C13H15NO3/c1-8-5-10(16-3)6-12(17-4)13(8)11(7-14)9(2)15/h5-6,11H,1-4H3 |
| InChIKey | QPYYJCGUMYCXDI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |