C24H26F2 — CID 20683357
1,3-difluoro-5-(4-methylcyclohexyl)-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene (PubChem CID 20683357) has the molecular formula C24H26F2 and a molecular weight of 352.47 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-methylcyclohexyl)-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene.
| Compound Name | 1,3-difluoro-5-(4-methylcyclohexyl)-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 20683357 |
| Molecular Formula | C24H26F2 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1,3-difluoro-5-(4-methylcyclohexyl)-2-[2-(3,4,5-trimethylphenyl)ethynyl]benzene |
| SMILES | Cc1cc(C#Cc2c(F)cc(C3CCC(C)CC3)cc2F)cc(C)c1C |
| InChI | InChI=1S/C24H26F2/c1-15-5-8-20(9-6-15)21-13-23(25)22(24(26)14-21)10-7-19-11-16(2)18(4)17(3)12-19/h11-15,20H,5-6,8-9H2,1-4H3 |
| InChIKey | LCWRMFYNEUPRRQ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|