C32H20ClF9O — CID 129036607
1-chloro-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-3-fluoro-5-pentylbenzene (PubChem CID 129036607) has the molecular formula C32H20ClF9O and a molecular weight of 626.95 g/mol. Its IUPAC name is 1-chloro-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-3-fluoro-5-pentylbenzene.
| Compound Name | 1-chloro-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-3-fluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 129036607 |
| Molecular Formula | C32H20ClF9O |
| Molecular Weight | 626.95 g/mol |
| Exact Mass | 626.11 |
| IUPAC Name | 1-chloro-2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-3-fluorophenyl]-3-fluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(-c2ccc(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C32H20ClF9O/c1-2-3-4-5-17-10-22(33)29(24(35)11-17)20-9-8-19(23(34)14-20)7-6-18-12-25(36)30(26(37)13-18)32(41,42)43-21-15-27(38)31(40)28(39)16-21/h8-16H,2-5H2,1H3 |
| InChIKey | MOBVVKBETLYPEZ-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.95 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|