C29H19ClF8O — CID 59583236
5-[[4-(4-butylphenyl)-2-chloro-6-fluorophenyl]-difluoromethoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene (PubChem CID 59583236) has the molecular formula C29H19ClF8O and a molecular weight of 570.91 g/mol. Its IUPAC name is 5-[[4-(4-butylphenyl)-2-chloro-6-fluorophenyl]-difluoromethoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 5-[[4-(4-butylphenyl)-2-chloro-6-fluorophenyl]-difluoromethoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 59583236 |
| Molecular Formula | C29H19ClF8O |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 5-[[4-(4-butylphenyl)-2-chloro-6-fluorophenyl]-difluoromethoxy]-1,3-difluoro-2-(3,4,5-trifluorophenyl)benzene |
| SMILES | CCCCc1ccc(-c2cc(F)c(C(F)(F)Oc3cc(F)c(-c4cc(F)c(F)c(F)c4)c(F)c3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C29H19ClF8O/c1-2-3-4-15-5-7-16(8-6-15)17-9-20(30)27(23(33)10-17)29(37,38)39-19-13-21(31)26(22(32)14-19)18-11-24(34)28(36)25(35)12-18/h5-14H,2-4H2,1H3 |
| InChIKey | UDXFDLJUXXMAEK-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|