C33H20F8O — CID 129037507
5-[[4-[2-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-fluorophenyl]ethynyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene (PubChem CID 129037507) has the molecular formula C33H20F8O and a molecular weight of 584.51 g/mol. Its IUPAC name is 5-[[4-[2-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-fluorophenyl]ethynyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene.
| Compound Name | 5-[[4-[2-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-fluorophenyl]ethynyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 129037507 |
| Molecular Formula | C33H20F8O |
| Molecular Weight | 584.51 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 5-[[4-[2-[4-[2-(4-butyl-2-fluorophenyl)ethynyl]-2-fluorophenyl]ethynyl]-2-fluorophenyl]-difluoromethoxy]-1,2,3-trifluorobenzene |
| SMILES | CCCCc1ccc(C#Cc2ccc(C#Cc3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C33H20F8O/c1-2-3-4-20-5-10-23(27(34)15-20)11-6-21-7-12-24(28(35)16-21)13-8-22-9-14-26(29(36)17-22)33(40,41)42-25-18-30(37)32(39)31(38)19-25/h5,7,9-10,12,14-19H,2-4H2,1H3 |
| InChIKey | WGOFMICQDHKBBP-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.51 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|