C31H17F7O2 — CID 129036345
5-[2-[4-[[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]ethynyl]-1,2,3-trifluorobenzene (PubChem CID 129036345) has the molecular formula C31H17F7O2 and a molecular weight of 554.46 g/mol. Its IUPAC name is 5-[2-[4-[[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]ethynyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[2-[4-[[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]ethynyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 129036345 |
| Molecular Formula | C31H17F7O2 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | 5-[2-[4-[[4-[2-(4-ethoxyphenyl)ethynyl]-2-fluorophenyl]-difluoromethoxy]-2-fluorophenyl]ethynyl]-1,2,3-trifluorobenzene |
| SMILES | CCOc1ccc(C#Cc2ccc(C(F)(F)Oc3ccc(C#Cc4cc(F)c(F)c(F)c4)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H17F7O2/c1-2-39-23-11-6-19(7-12-23)3-4-20-8-14-25(27(33)15-20)31(37,38)40-24-13-10-22(26(32)18-24)9-5-21-16-28(34)30(36)29(35)17-21/h6-8,10-18H,2H2,1H3 |
| InChIKey | GEXQITIDUBCKST-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|