C24H19F5O2 — CID 134222318
5-[[4-(4-but-3-enylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-(fluoromethoxy)benzene (PubChem CID 134222318) has the molecular formula C24H19F5O2 and a molecular weight of 434.40 g/mol. Its IUPAC name is 5-[[4-(4-but-3-enylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-(fluoromethoxy)benzene.
| Compound Name | 5-[[4-(4-but-3-enylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-(fluoromethoxy)benzene |
|---|---|
| PubChem CID | 134222318 |
| Molecular Formula | C24H19F5O2 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-[[4-(4-but-3-enylphenyl)phenyl]-difluoromethoxy]-1,3-difluoro-2-(fluoromethoxy)benzene |
| SMILES | C=CCCc1ccc(-c2ccc(C(F)(F)Oc3cc(F)c(OCF)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C24H19F5O2/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-19(12-10-18)24(28,29)31-20-13-21(26)23(30-15-25)22(27)14-20/h2,5-14H,1,3-4,15H2 |
| InChIKey | HDMYJSWCJCWUAM-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|