C25H19F5N4 — CID 118593544
2-[2,3-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-(5-pentylpyrimidin-2-yl)pyrimidine (PubChem CID 118593544) has the molecular formula C25H19F5N4 and a molecular weight of 470.45 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-(5-pentylpyrimidin-2-yl)pyrimidine.
| Compound Name | 2-[2,3-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-(5-pentylpyrimidin-2-yl)pyrimidine |
|---|---|
| PubChem CID | 118593544 |
| Molecular Formula | C25H19F5N4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-[2,3-difluoro-4-(3,4,5-trifluorophenyl)phenyl]-5-(5-pentylpyrimidin-2-yl)pyrimidine |
| SMILES | CCCCCc1cnc(-c2cnc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3F)nc2)nc1 |
| InChI | InChI=1S/C25H19F5N4/c1-2-3-4-5-14-10-31-24(32-11-14)16-12-33-25(34-13-16)18-7-6-17(21(28)22(18)29)15-8-19(26)23(30)20(27)9-15/h6-13H,2-5H2,1H3 |
| InChIKey | SQUVMZHPQFGTOF-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|