C15H18BrF5Si — CID 54200175
1-(3-bromopropyl)-4-[3,5-difluoro-4-(trifluoromethyl)phenyl]silinane (PubChem CID 54200175) has the molecular formula C15H18BrF5Si and a molecular weight of 401.29 g/mol. Its IUPAC name is 1-(3-bromopropyl)-4-[3,5-difluoro-4-(trifluoromethyl)phenyl]silinane.
| Compound Name | 1-(3-bromopropyl)-4-[3,5-difluoro-4-(trifluoromethyl)phenyl]silinane |
|---|---|
| PubChem CID | 54200175 |
| Molecular Formula | C15H18BrF5Si |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 1-(3-bromopropyl)-4-[3,5-difluoro-4-(trifluoromethyl)phenyl]silinane |
| SMILES | Fc1cc(C2CC[SiH](CCCBr)CC2)cc(F)c1C(F)(F)F |
| InChI | InChI=1S/C15H18BrF5Si/c16-4-1-5-22-6-2-10(3-7-22)11-8-12(17)14(13(18)9-11)15(19,20)21/h8-10,22H,1-7H2 |
| InChIKey | PORCWZCOBUNTSJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|