C21H26F6O2 — CID 20663408
1-[2,6-difluoro-4-[4-[4-(fluoromethyl)cyclohexyl]cyclohexyl]phenoxy]-2,2,2-trifluoroethanol (PubChem CID 20663408) has the molecular formula C21H26F6O2 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-[2,6-difluoro-4-[4-[4-(fluoromethyl)cyclohexyl]cyclohexyl]phenoxy]-2,2,2-trifluoroethanol.
| Compound Name | 1-[2,6-difluoro-4-[4-[4-(fluoromethyl)cyclohexyl]cyclohexyl]phenoxy]-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 20663408 |
| Molecular Formula | C21H26F6O2 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[2,6-difluoro-4-[4-[4-(fluoromethyl)cyclohexyl]cyclohexyl]phenoxy]-2,2,2-trifluoroethanol |
| SMILES | OC(Oc1c(F)cc(C2CCC(C3CCC(CF)CC3)CC2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C21H26F6O2/c22-11-12-1-3-13(4-2-12)14-5-7-15(8-6-14)16-9-17(23)19(18(24)10-16)29-20(28)21(25,26)27/h9-10,12-15,20,28H,1-8,11H2 |
| InChIKey | XSLVIANRZHZMIK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|