C27H34F2O — CID 59734850
1,3-difluoro-2-hexa-3,5-diyn-2-yloxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 59734850) has the molecular formula C27H34F2O and a molecular weight of 412.56 g/mol. Its IUPAC name is 1,3-difluoro-2-hexa-3,5-diyn-2-yloxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1,3-difluoro-2-hexa-3,5-diyn-2-yloxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 59734850 |
| Molecular Formula | C27H34F2O |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1,3-difluoro-2-hexa-3,5-diyn-2-yloxy-5-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | C#CC#CC(C)Oc1c(F)cc(C2CCC(C3CCC(CCC)CC3)CC2)cc1F |
| InChI | InChI=1S/C27H34F2O/c1-4-6-8-19(3)30-27-25(28)17-24(18-26(27)29)23-15-13-22(14-16-23)21-11-9-20(7-5-2)10-12-21/h1,17-23H,5,7,9-16H2,2-3H3 |
| InChIKey | UAYYKTSMJZNTOU-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|