About 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane
4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane (PubChem CID 54732591) has the molecular formula C16H23F3OSi
and a molecular weight of 316.44 g/mol. Its IUPAC name is 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane.
Molecular Properties
| Compound Name | 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane |
| PubChem CID | 54732591 |
| Molecular Formula | C16H23F3OSi |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane |
| SMILES | FCCCC[SiH]1CCC(COc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H23F3OSi/c17-7-1-2-8-21-9-5-13(6-10-21)12-20-14-3-4-15(18)16(19)11-14/h3-4,11,13,21H,1-2,5-10,12H2 |
| InChIKey | GDDZWFAQGREWFB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane?
The IUPAC name of 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane (CID 54732591) is 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane.
What is the SMILES notation for 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane?
The canonical SMILES for 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane is FCCCC[SiH]1CCC(COc2ccc(F)c(F)c2)CC1.
What is the InChIKey of 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane?
The InChIKey is GDDZWFAQGREWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F3OSi/c17-7-1-2-8-21-9-5-13(6-10-21)12-20-14-3-4-15(18)16(19)11-14/h3-4,11,13,21H,1-2,5-10,12H2.
What are the key properties of 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane?
4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane has a molecular weight of 316.44 g/mol, XLogP of 4.73, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-difluorophenoxy)methyl]-1-(4-fluorobutyl)silinane is sourced from PubChem (CID 54732591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).