C23H35F3OSi — CID 70260076
4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1-(4-fluorobutyl)silinane (PubChem CID 70260076) has the molecular formula C23H35F3OSi and a molecular weight of 412.61 g/mol. Its IUPAC name is 4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1-(4-fluorobutyl)silinane.
| Compound Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1-(4-fluorobutyl)silinane |
|---|---|
| PubChem CID | 70260076 |
| Molecular Formula | C23H35F3OSi |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 4-[4-(4-ethoxy-2,3-difluorophenyl)cyclohexyl]-1-(4-fluorobutyl)silinane |
| SMILES | CCOc1ccc(C2CCC(C3CC[SiH](CCCCF)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C23H35F3OSi/c1-2-27-21-10-9-20(22(25)23(21)26)19-7-5-17(6-8-19)18-11-15-28(16-12-18)14-4-3-13-24/h9-10,17-19,28H,2-8,11-16H2,1H3 |
| InChIKey | JZVDJYOQZZKDTQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|