C31H42ClF7O — CID 18344226
2-[chloro(difluoro)methoxy]-5-[4-[4-[2,2-difluoro-2-[4-(4-fluorobutyl)cyclohexyl]ethyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene (PubChem CID 18344226) has the molecular formula C31H42ClF7O and a molecular weight of 599.12 g/mol. Its IUPAC name is 2-[chloro(difluoro)methoxy]-5-[4-[4-[2,2-difluoro-2-[4-(4-fluorobutyl)cyclohexyl]ethyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene.
| Compound Name | 2-[chloro(difluoro)methoxy]-5-[4-[4-[2,2-difluoro-2-[4-(4-fluorobutyl)cyclohexyl]ethyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 18344226 |
| Molecular Formula | C31H42ClF7O |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2-[chloro(difluoro)methoxy]-5-[4-[4-[2,2-difluoro-2-[4-(4-fluorobutyl)cyclohexyl]ethyl]cyclohexyl]cyclohexyl]-1,3-difluorobenzene |
| SMILES | FCCCCC1CCC(C(F)(F)CC2CCC(C3CCC(c4cc(F)c(OC(F)(F)Cl)c(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H42ClF7O/c32-31(38,39)40-29-27(34)17-25(18-28(29)35)24-12-10-23(11-13-24)22-8-4-21(5-9-22)19-30(36,37)26-14-6-20(7-15-26)3-1-2-16-33/h17-18,20-24,26H,1-16,19H2 |
| InChIKey | NGNQTMMRHGKWKB-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|