C31H42F8O — CID 18344422
5-[4-[2,2-difluoro-2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]-1,3-difluoro-2-(1,1,2,2-tetrafluoroethoxy)benzene (PubChem CID 18344422) has the molecular formula C31H42F8O and a molecular weight of 582.66 g/mol. Its IUPAC name is 5-[4-[2,2-difluoro-2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]-1,3-difluoro-2-(1,1,2,2-tetrafluoroethoxy)benzene.
| Compound Name | 5-[4-[2,2-difluoro-2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]-1,3-difluoro-2-(1,1,2,2-tetrafluoroethoxy)benzene |
|---|---|
| PubChem CID | 18344422 |
| Molecular Formula | C31H42F8O |
| Molecular Weight | 582.66 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 5-[4-[2,2-difluoro-2-[4-(4-propylcyclohexyl)cyclohexyl]ethyl]cyclohexyl]-1,3-difluoro-2-(1,1,2,2-tetrafluoroethoxy)benzene |
| SMILES | CCCC1CCC(C2CCC(C(F)(F)CC3CCC(c4cc(F)c(OC(F)(F)C(F)F)c(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H42F8O/c1-2-3-19-4-8-21(9-5-19)22-12-14-25(15-13-22)30(36,37)18-20-6-10-23(11-7-20)24-16-26(32)28(27(33)17-24)40-31(38,39)29(34)35/h16-17,19-23,25,29H,2-15,18H2,1H3 |
| InChIKey | UPEYKJQWFYFADU-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.66 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|