C18H21F3O2 — CID 149357112
5-ethenyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane (PubChem CID 149357112) has the molecular formula C18H21F3O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-ethenyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane.
| Compound Name | 5-ethenyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 149357112 |
| Molecular Formula | C18H21F3O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 5-ethenyl-2-[4-(3,4,5-trifluorophenyl)cyclohexyl]-1,3-dioxane |
| SMILES | C=CC1COC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C18H21F3O2/c1-2-11-9-22-18(23-10-11)13-5-3-12(4-6-13)14-7-15(19)17(21)16(20)8-14/h2,7-8,11-13,18H,1,3-6,9-10H2 |
| InChIKey | YHDYWUCUSDLKIU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|