C40H52F2O5 — CID 140976217
5-ethenyl-2-[4-[4-[2-[2-[4-[4-(5-ethenyl-1,3-dioxan-2-yl)cyclohexyl]-2-fluorophenyl]ethoxy]ethyl]-3-fluorophenyl]cyclohexyl]-1,3-dioxane (PubChem CID 140976217) has the molecular formula C40H52F2O5 and a molecular weight of 650.85 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[4-[2-[2-[4-[4-(5-ethenyl-1,3-dioxan-2-yl)cyclohexyl]-2-fluorophenyl]ethoxy]ethyl]-3-fluorophenyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-ethenyl-2-[4-[4-[2-[2-[4-[4-(5-ethenyl-1,3-dioxan-2-yl)cyclohexyl]-2-fluorophenyl]ethoxy]ethyl]-3-fluorophenyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 140976217 |
| Molecular Formula | C40H52F2O5 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | 5-ethenyl-2-[4-[4-[2-[2-[4-[4-(5-ethenyl-1,3-dioxan-2-yl)cyclohexyl]-2-fluorophenyl]ethoxy]ethyl]-3-fluorophenyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CC1COC(C2CCC(c3ccc(CCOCCc4ccc(C5CCC(C6OCC(C=C)CO6)CC5)cc4F)c(F)c3)CC2)OC1 |
| InChI | InChI=1S/C40H52F2O5/c1-3-27-23-44-39(45-24-27)33-11-5-29(6-12-33)35-15-9-31(37(41)21-35)17-19-43-20-18-32-10-16-36(22-38(32)42)30-7-13-34(14-8-30)40-46-25-28(4-2)26-47-40/h3-4,9-10,15-16,21-22,27-30,33-34,39-40H,1-2,5-8,11-14,17-20,23-26H2 |
| InChIKey | BQECVETUJSONJL-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|