C25H31ClF4O2 — CID 20653842
2-[4-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]cyclohexyl]-5-ethenyl-1,3-dioxane (PubChem CID 20653842) has the molecular formula C25H31ClF4O2 and a molecular weight of 474.97 g/mol. Its IUPAC name is 2-[4-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]cyclohexyl]-5-ethenyl-1,3-dioxane.
| Compound Name | 2-[4-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]cyclohexyl]-5-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 20653842 |
| Molecular Formula | C25H31ClF4O2 |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[4-[4-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]cyclohexyl]cyclohexyl]-5-ethenyl-1,3-dioxane |
| SMILES | C=CC1COC(C2CCC(C3CCC(c4cc(F)c(C(F)(F)Cl)c(F)c4)CC3)CC2)OC1 |
| InChI | InChI=1S/C25H31ClF4O2/c1-2-15-13-31-24(32-14-15)19-9-7-17(8-10-19)16-3-5-18(6-4-16)20-11-21(27)23(22(28)12-20)25(26,29)30/h2,11-12,15-19,24H,1,3-10,13-14H2 |
| InChIKey | DMDPEMFPNLPFRD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|