C13H12ClF5 — CID 18344229
2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene (PubChem CID 18344229) has the molecular formula C13H12ClF5 and a molecular weight of 298.68 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene.
| Compound Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene |
|---|---|
| PubChem CID | 18344229 |
| Molecular Formula | C13H12ClF5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-1,3-difluoro-5-(4-fluorocyclohexyl)benzene |
| SMILES | Fc1cc(C2CCC(F)CC2)cc(F)c1C(F)(F)Cl |
| InChI | InChI=1S/C13H12ClF5/c14-13(18,19)12-10(16)5-8(6-11(12)17)7-1-3-9(15)4-2-7/h5-7,9H,1-4H2 |
| InChIKey | UJDWPGNEAOESJH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|