C19H21ClF4O2 — CID 20653922
2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane (PubChem CID 20653922) has the molecular formula C19H21ClF4O2 and a molecular weight of 392.82 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane.
| Compound Name | 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane |
|---|---|
| PubChem CID | 20653922 |
| Molecular Formula | C19H21ClF4O2 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-(4-ethenylcyclohexyl)-1,3-dioxane |
| SMILES | C=CC1CCC(C2COC(c3cc(F)c(C(F)(F)Cl)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C19H21ClF4O2/c1-2-11-3-5-12(6-4-11)14-9-25-18(26-10-14)13-7-15(21)17(16(22)8-13)19(20,23)24/h2,7-8,11-12,14,18H,1,3-6,9-10H2 |
| InChIKey | HNJHEIVDYDLVAN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|