C25H33ClF4 — CID 20654101
2-[chloro(difluoro)methyl]-5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]butyl]-1,3-difluorobenzene (PubChem CID 20654101) has the molecular formula C25H33ClF4 and a molecular weight of 444.98 g/mol. Its IUPAC name is 2-[chloro(difluoro)methyl]-5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]butyl]-1,3-difluorobenzene.
| Compound Name | 2-[chloro(difluoro)methyl]-5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]butyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 20654101 |
| Molecular Formula | C25H33ClF4 |
| Molecular Weight | 444.98 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[chloro(difluoro)methyl]-5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]butyl]-1,3-difluorobenzene |
| SMILES | C=CC1CCC(C2CCC(CCCCc3cc(F)c(C(F)(F)Cl)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H33ClF4/c1-2-17-7-11-20(12-8-17)21-13-9-18(10-14-21)5-3-4-6-19-15-22(27)24(23(28)16-19)25(26,29)30/h2,15-18,20-21H,1,3-14H2 |
| InChIKey | CYZUXWUTPXASAP-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.98 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|