C21H25F2N — CID 54309472
5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]penta-2,4-dienenitrile (PubChem CID 54309472) has the molecular formula C21H25F2N and a molecular weight of 329.43 g/mol. Its IUPAC name is 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]penta-2,4-dienenitrile.
| Compound Name | 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54309472 |
| Molecular Formula | C21H25F2N |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-[4-[4-(3,4-difluorophenyl)butyl]cyclohexyl]penta-2,4-dienenitrile |
| SMILES | N#CC=CC=CC1CCC(CCCCc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C21H25F2N/c22-20-14-13-19(16-21(20)23)8-4-3-7-18-11-9-17(10-12-18)6-2-1-5-15-24/h1-2,5-6,13-14,16-18H,3-4,7-12H2 |
| InChIKey | SJWWJVNITIFIPS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|