C24H31ClF4O2 — CID 20653916
2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]-1,3-dioxane (PubChem CID 20653916) has the molecular formula C24H31ClF4O2 and a molecular weight of 462.96 g/mol. Its IUPAC name is 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]-1,3-dioxane.
| Compound Name | 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 20653916 |
| Molecular Formula | C24H31ClF4O2 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-[4-[chloro(difluoro)methyl]-3,5-difluorophenyl]-5-[2-[4-[(E)-pent-3-enyl]cyclohexyl]ethyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1CCC(CCC2COC(c3cc(F)c(C(F)(F)Cl)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C24H31ClF4O2/c1-2-3-4-5-16-6-8-17(9-7-16)10-11-18-14-30-23(31-15-18)19-12-20(26)22(21(27)13-19)24(25,28)29/h2-3,12-13,16-18,23H,4-11,14-15H2,1H3/b3-2+ |
| InChIKey | VQRWDTWKKQSCMQ-NSCUHMNNSA-N |
| XLogP | 7.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|