C16H19F3O2 — CID 70950758
2-[3,5-difluoro-4-(fluoromethyl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane (PubChem CID 70950758) has the molecular formula C16H19F3O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-(fluoromethyl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane.
| Compound Name | 2-[3,5-difluoro-4-(fluoromethyl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 70950758 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-[3,5-difluoro-4-(fluoromethyl)phenyl]-5-[(E)-pent-3-enyl]-1,3-dioxane |
| SMILES | C/C=C/CCC1COC(c2cc(F)c(CF)c(F)c2)OC1 |
| InChI | InChI=1S/C16H19F3O2/c1-2-3-4-5-11-9-20-16(21-10-11)12-6-14(18)13(8-17)15(19)7-12/h2-3,6-7,11,16H,4-5,8-10H2,1H3/b3-2+ |
| InChIKey | LRGSAIPWKATIHM-NSCUHMNNSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|