C32H35F5 — CID 88993373
5-(4-ethenylcyclohexyl)-1,3-difluoro-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexen-1-yl]benzene (PubChem CID 88993373) has the molecular formula C32H35F5 and a molecular weight of 514.62 g/mol. Its IUPAC name is 5-(4-ethenylcyclohexyl)-1,3-difluoro-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexen-1-yl]benzene.
| Compound Name | 5-(4-ethenylcyclohexyl)-1,3-difluoro-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexen-1-yl]benzene |
|---|---|
| PubChem CID | 88993373 |
| Molecular Formula | C32H35F5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 5-(4-ethenylcyclohexyl)-1,3-difluoro-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexen-1-yl]benzene |
| SMILES | C=CC1CCC(c2cc(F)c(C3=CCC(C4CCC(c5cc(F)c(F)c(F)c5)CC4)CC3)c(F)c2)CC1 |
| InChI | InChI=1S/C32H35F5/c1-2-19-3-5-22(6-4-19)25-15-27(33)31(28(34)16-25)24-13-11-21(12-14-24)20-7-9-23(10-8-20)26-17-29(35)32(37)30(36)18-26/h2,13,15-23H,1,3-12,14H2 |
| InChIKey | XCJXIMUZIWAFBV-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|