C16H26F2 — CID 139748793
1-(2,2-difluoroethyl)-4-(4-ethenylcyclohexyl)cyclohexane (PubChem CID 139748793) has the molecular formula C16H26F2 and a molecular weight of 256.38 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-(4-ethenylcyclohexyl)cyclohexane.
| Compound Name | 1-(2,2-difluoroethyl)-4-(4-ethenylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 139748793 |
| Molecular Formula | C16H26F2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-(4-ethenylcyclohexyl)cyclohexane |
| SMILES | C=CC1CCC(C2CCC(CC(F)F)CC2)CC1 |
| InChI | InChI=1S/C16H26F2/c1-2-12-3-7-14(8-4-12)15-9-5-13(6-10-15)11-16(17)18/h2,12-16H,1,3-11H2 |
| InChIKey | ZPMZBTCCUMGNJB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|