C23H31NO6 — CID 101239618
tert-butyl N-[5-[(2R,4aR,6S,8aS)-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-4-oxopentyl]carbamate (PubChem CID 101239618) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is tert-butyl N-[5-[(2R,4aR,6S,8aS)-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-4-oxopentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2R,4aR,6S,8aS)-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-4-oxopentyl]carbamate |
|---|---|
| PubChem CID | 101239618 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | tert-butyl N-[5-[(2R,4aR,6S,8aS)-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-yl]-4-oxopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)C[C@H]1C=C[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C23H31NO6/c1-23(2,3)30-22(26)24-13-7-10-17(25)14-18-11-12-19-20(28-18)15-27-21(29-19)16-8-5-4-6-9-16/h4-6,8-9,11-12,18-21H,7,10,13-15H2,1-3H3,(H,24,26)/t18-,19+,20-,21-/m1/s1 |
| InChIKey | MSEHIFUHQOAFTK-PLACYPQZSA-N |
| XLogP | 3.69 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|