C33H48N2O12 — CID 134560241
tert-butyl N-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]carbamate (PubChem CID 134560241) has the molecular formula C33H48N2O12 and a molecular weight of 664.75 g/mol. Its IUPAC name is tert-butyl N-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 134560241 |
| Molecular Formula | C33H48N2O12 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | tert-butyl N-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCN(C[C@H](O)[C@@H](O)[C@@H]1OC(c2ccccc2)OC[C@H]1O)C[C@H](O)[C@@H](O)[C@@H]1OC(c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C33H48N2O12/c1-33(2,3)47-32(42)34-14-15-35(16-22(36)26(40)28-24(38)18-43-30(45-28)20-10-6-4-7-11-20)17-23(37)27(41)29-25(39)19-44-31(46-29)21-12-8-5-9-13-21/h4-13,22-31,36-41H,14-19H2,1-3H3,(H,34,42)/t22-,23-,24+,25+,26+,27+,28+,29+,30?,31?/m0/s1 |
| InChIKey | ZWDQCKSIZWHGIO-KFWFLNGKSA-N |
| XLogP | 0.21 |
| TPSA | 199.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |