C37H54N2O12 — CID 142755301
tert-butyl N-[4-[bis[(2S,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]cyclohexyl]carbamate (PubChem CID 142755301) has the molecular formula C37H54N2O12 and a molecular weight of 718.84 g/mol. Its IUPAC name is tert-butyl N-[4-[bis[(2S,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[bis[(2S,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 142755301 |
| Molecular Formula | C37H54N2O12 |
| Molecular Weight | 718.84 g/mol |
| Exact Mass | 718.37 |
| IUPAC Name | tert-butyl N-[4-[bis[(2S,3R)-2,3-dihydroxy-3-[(2R,4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(N(C[C@H](O)[C@@H](O)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O)C[C@H](O)[C@@H](O)[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O)CC1 |
| InChI | InChI=1S/C37H54N2O12/c1-37(2,3)51-36(46)38-24-14-16-25(17-15-24)39(18-26(40)30(44)32-28(42)20-47-34(49-32)22-10-6-4-7-11-22)19-27(41)31(45)33-29(43)21-48-35(50-33)23-12-8-5-9-13-23/h4-13,24-35,40-45H,14-21H2,1-3H3,(H,38,46)/t24?,25?,26-,27-,28+,29+,30+,31+,32+,33+,34+,35+/m0/s1 |
| InChIKey | DYUUNLGRRBWVTE-GCNKTNCJSA-N |
| XLogP | 1.52 |
| TPSA | 199.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.84 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |