C47H60N2O12 — CID 134560244
tert-butyl N-[2-[4-[4-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]phenyl]phenyl]ethyl]carbamate (PubChem CID 134560244) has the molecular formula C47H60N2O12 and a molecular weight of 845.00 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[4-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]phenyl]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[4-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]phenyl]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 134560244 |
| Molecular Formula | C47H60N2O12 |
| Molecular Weight | 845.00 g/mol |
| Exact Mass | 844.41 |
| IUPAC Name | tert-butyl N-[2-[4-[4-[2-[bis[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]ethyl]phenyl]phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(-c2ccc(CCN(C[C@H](O)[C@@H](O)[C@@H]3OC(c4ccccc4)OC[C@H]3O)C[C@H](O)[C@@H](O)[C@@H]3OC(c4ccccc4)OC[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C47H60N2O12/c1-47(2,3)61-46(56)48-24-22-30-14-18-32(19-15-30)33-20-16-31(17-21-33)23-25-49(26-36(50)40(54)42-38(52)28-57-44(59-42)34-10-6-4-7-11-34)27-37(51)41(55)43-39(53)29-58-45(60-43)35-12-8-5-9-13-35/h4-21,36-45,50-55H,22-29H2,1-3H3,(H,48,56)/t36-,37-,38+,39+,40+,41+,42+,43+,44?,45?/m0/s1 |
| InChIKey | DXKGWNHBONCYDK-UEFQPVQASA-N |
| XLogP | 3.66 |
| TPSA | 199.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.00 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |