C30H43NO10 — CID 90225375
(1R,2S)-3-[butyl-[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]-1-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propane-1,2-diol (PubChem CID 90225375) has the molecular formula C30H43NO10 and a molecular weight of 577.67 g/mol. Its IUPAC name is (1R,2S)-3-[butyl-[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]-1-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propane-1,2-diol.
| Compound Name | (1R,2S)-3-[butyl-[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]-1-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 90225375 |
| Molecular Formula | C30H43NO10 |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | (1R,2S)-3-[butyl-[(2S,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propyl]amino]-1-[(4R,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]propane-1,2-diol |
| SMILES | CCCCN(C[C@H](O)[C@@H](O)[C@@H]1OC(c2ccccc2)OC[C@H]1O)C[C@H](O)[C@@H](O)[C@@H]1OC(c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C30H43NO10/c1-2-3-14-31(15-21(32)25(36)27-23(34)17-38-29(40-27)19-10-6-4-7-11-19)16-22(33)26(37)28-24(35)18-39-30(41-28)20-12-8-5-9-13-20/h4-13,21-30,32-37H,2-3,14-18H2,1H3/t21-,22-,23+,24+,25+,26+,27+,28+,29?,30?/m0/s1 |
| InChIKey | HFOJFKCPEAMVNY-QTRNWOFMSA-N |
| XLogP | 0.48 |
| TPSA | 161.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |