C20H33N3O3 — CID 130198895
tert-butyl N-[1-[2-hydroxy-3-(N-methylanilino)propyl]piperidin-4-yl]carbamate (PubChem CID 130198895) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl N-[1-[2-hydroxy-3-(N-methylanilino)propyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-hydroxy-3-(N-methylanilino)propyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 130198895 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | tert-butyl N-[1-[2-hydroxy-3-(N-methylanilino)propyl]piperidin-4-yl]carbamate |
| SMILES | CN(CC(O)CN1CCC(NC(=O)OC(C)(C)C)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H33N3O3/c1-20(2,3)26-19(25)21-16-10-12-23(13-11-16)15-18(24)14-22(4)17-8-6-5-7-9-17/h5-9,16,18,24H,10-15H2,1-4H3,(H,21,25) |
| InChIKey | SUDRAGIUHICUMG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |