C19H28F2N2O4 — CID 55989113
tert-butyl N-[1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]piperidin-4-yl]carbamate (PubChem CID 55989113) has the molecular formula C19H28F2N2O4 and a molecular weight of 386.44 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55989113 |
| Molecular Formula | C19H28F2N2O4 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | tert-butyl N-[1-[2-[4-(difluoromethoxy)phenyl]-2-hydroxyethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(O)c2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H28F2N2O4/c1-19(2,3)27-18(25)22-14-8-10-23(11-9-14)12-16(24)13-4-6-15(7-5-13)26-17(20)21/h4-7,14,16-17,24H,8-12H2,1-3H3,(H,22,25) |
| InChIKey | KKPUKUGUNRGSAT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |