C20H32N2O3 — CID 111496308
tert-butyl N-[[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]methyl]carbamate (PubChem CID 111496308) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 111496308 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | tert-butyl N-[[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]methyl]carbamate |
| SMILES | Cc1ccc(C(O)CN2CCC(CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H32N2O3/c1-15-5-7-17(8-6-15)18(23)14-22-11-9-16(10-12-22)13-21-19(24)25-20(2,3)4/h5-8,16,18,23H,9-14H2,1-4H3,(H,21,24) |
| InChIKey | WYZNCDQOKUGOKJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |