C18H27NO3 — CID 111974949
methyl 3-[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]propanoate (PubChem CID 111974949) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is methyl 3-[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]propanoate.
| Compound Name | methyl 3-[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 111974949 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | methyl 3-[1-[2-hydroxy-2-(4-methylphenyl)ethyl]piperidin-4-yl]propanoate |
| SMILES | COC(=O)CCC1CCN(CC(O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C18H27NO3/c1-14-3-6-16(7-4-14)17(20)13-19-11-9-15(10-12-19)5-8-18(21)22-2/h3-4,6-7,15,17,20H,5,8-13H2,1-2H3 |
| InChIKey | GMYVGWZKPBBEEW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |