C21H30O4 — CID 102312826
(2S,4R,5R)-4-[(1S,2S)-2-ethenyl-1-hydroxy-2,6-dimethylhept-5-enyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 102312826) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2S,4R,5R)-4-[(1S,2S)-2-ethenyl-1-hydroxy-2,6-dimethylhept-5-enyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2S,4R,5R)-4-[(1S,2S)-2-ethenyl-1-hydroxy-2,6-dimethylhept-5-enyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 102312826 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2S,4R,5R)-4-[(1S,2S)-2-ethenyl-1-hydroxy-2,6-dimethylhept-5-enyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | C=C[C@](C)(CCC=C(C)C)[C@H](O)[C@H]1O[C@@H](c2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C21H30O4/c1-5-21(4,13-9-10-15(2)3)19(23)18-17(22)14-24-20(25-18)16-11-7-6-8-12-16/h5-8,10-12,17-20,22-23H,1,9,13-14H2,2-4H3/t17-,18+,19-,20+,21-/m1/s1 |
| InChIKey | FQRNBTFTHRLSTE-VIYGXFRKSA-N |
| XLogP | 3.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|