C28H31NO6 — CID 10600695
(2R,4R)-4-[(1R,2S,3E)-3-methoxyimino-1,2-bis(phenylmethoxy)propyl]-2-phenyl-1,3-dioxan-5-ol (PubChem CID 10600695) has the molecular formula C28H31NO6 and a molecular weight of 477.56 g/mol. Its IUPAC name is (2R,4R)-4-[(1R,2S,3E)-3-methoxyimino-1,2-bis(phenylmethoxy)propyl]-2-phenyl-1,3-dioxan-5-ol.
| Compound Name | (2R,4R)-4-[(1R,2S,3E)-3-methoxyimino-1,2-bis(phenylmethoxy)propyl]-2-phenyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 10600695 |
| Molecular Formula | C28H31NO6 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (2R,4R)-4-[(1R,2S,3E)-3-methoxyimino-1,2-bis(phenylmethoxy)propyl]-2-phenyl-1,3-dioxan-5-ol |
| SMILES | CO/N=C/[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H]1O[C@H](c2ccccc2)OCC1O |
| InChI | InChI=1S/C28H31NO6/c1-31-29-17-25(32-18-21-11-5-2-6-12-21)27(33-19-22-13-7-3-8-14-22)26-24(30)20-34-28(35-26)23-15-9-4-10-16-23/h2-17,24-28,30H,18-20H2,1H3/b29-17+/t24?,25-,26+,27+,28+/m0/s1 |
| InChIKey | ZGEHQCGWKPCSBI-QQQNVOSISA-N |
| XLogP | 4.26 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|