C23H34O2 — CID 11336827
2-ethenyl-1-[4-(1-hydroxy-2,2-dimethylbut-3-enyl)phenyl]-2,6-dimethylhept-5-en-1-ol (PubChem CID 11336827) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-ethenyl-1-[4-(1-hydroxy-2,2-dimethylbut-3-enyl)phenyl]-2,6-dimethylhept-5-en-1-ol.
| Compound Name | 2-ethenyl-1-[4-(1-hydroxy-2,2-dimethylbut-3-enyl)phenyl]-2,6-dimethylhept-5-en-1-ol |
|---|---|
| PubChem CID | 11336827 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-ethenyl-1-[4-(1-hydroxy-2,2-dimethylbut-3-enyl)phenyl]-2,6-dimethylhept-5-en-1-ol |
| SMILES | C=CC(C)(C)C(O)c1ccc(C(O)C(C)(C=C)CCC=C(C)C)cc1 |
| InChI | InChI=1S/C23H34O2/c1-8-22(5,6)20(24)18-12-14-19(15-13-18)21(25)23(7,9-2)16-10-11-17(3)4/h8-9,11-15,20-21,24-25H,1-2,10,16H2,3-7H3 |
| InChIKey | HDNQESCLKVYDHN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|