C20H22BNO2 — CID 14527861
4-[5-(4-butylphenyl)-1,3,2-dioxaborinan-2-yl]benzonitrile (PubChem CID 14527861) has the molecular formula C20H22BNO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is 4-[5-(4-butylphenyl)-1,3,2-dioxaborinan-2-yl]benzonitrile.
| Compound Name | 4-[5-(4-butylphenyl)-1,3,2-dioxaborinan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 14527861 |
| Molecular Formula | C20H22BNO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 4-[5-(4-butylphenyl)-1,3,2-dioxaborinan-2-yl]benzonitrile |
| SMILES | CCCCc1ccc(C2COB(c3ccc(C#N)cc3)OC2)cc1 |
| InChI | InChI=1S/C20H22BNO2/c1-2-3-4-16-5-9-18(10-6-16)19-14-23-21(24-15-19)20-11-7-17(13-22)8-12-20/h5-12,19H,2-4,14-15H2,1H3 |
| InChIKey | XLMUTJIBIFYYNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|