C13H19BO2 — CID 146013904
2-(4-butylphenyl)-1,3,2-dioxaborinane (PubChem CID 146013904) has the molecular formula C13H19BO2 and a molecular weight of 218.11 g/mol. Its IUPAC name is 2-(4-butylphenyl)-1,3,2-dioxaborinane.
| Compound Name | 2-(4-butylphenyl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 146013904 |
| Molecular Formula | C13H19BO2 |
| Molecular Weight | 218.11 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-(4-butylphenyl)-1,3,2-dioxaborinane |
| SMILES | CCCCc1ccc(B2OCCCO2)cc1 |
| InChI | InChI=1S/C13H19BO2/c1-2-3-5-12-6-8-13(9-7-12)14-15-10-4-11-16-14/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | XMSXJXBOZLATQF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.11 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|