C14H19BO2 — CID 154709124
CID 154709124 (PubChem CID 154709124) has the molecular formula C14H19BO2 and a molecular weight of 230.12 g/mol.
| Compound Name | CID 154709124 |
|---|---|
| PubChem CID | 154709124 |
| Molecular Formula | C14H19BO2 |
| Molecular Weight | 230.12 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | — |
| SMILES | [B][C@H](CCCC1CO1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H19BO2/c1-16-13-7-5-11(6-8-13)9-12(15)3-2-4-14-10-17-14/h5-8,12,14H,2-4,9-10H2,1H3/t12-,14?/m1/s1 |
| InChIKey | BRNRFIGLQZHPNQ-PUODRLBUSA-N |
| XLogP | 2.76 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|