C27H30O3 — CID 144713732
2-[3-[[4-(4-methoxyphenyl)phenyl]methyl]-4-methylphenyl]-6-methyloxan-4-ol (PubChem CID 144713732) has the molecular formula C27H30O3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-[3-[[4-(4-methoxyphenyl)phenyl]methyl]-4-methylphenyl]-6-methyloxan-4-ol.
| Compound Name | 2-[3-[[4-(4-methoxyphenyl)phenyl]methyl]-4-methylphenyl]-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 144713732 |
| Molecular Formula | C27H30O3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-[3-[[4-(4-methoxyphenyl)phenyl]methyl]-4-methylphenyl]-6-methyloxan-4-ol |
| SMILES | COc1ccc(-c2ccc(Cc3cc(C4CC(O)CC(C)O4)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C27H30O3/c1-18-4-7-23(27-17-25(28)14-19(2)30-27)16-24(18)15-20-5-8-21(9-6-20)22-10-12-26(29-3)13-11-22/h4-13,16,19,25,27-28H,14-15,17H2,1-3H3 |
| InChIKey | QSFXDFLZBGYBKB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |