C20H24O3 — CID 142057774
(2R,4S,6R)-2-[3-[(4-methoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol (PubChem CID 142057774) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R,4S,6R)-2-[3-[(4-methoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol.
| Compound Name | (2R,4S,6R)-2-[3-[(4-methoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol |
|---|---|
| PubChem CID | 142057774 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2R,4S,6R)-2-[3-[(4-methoxyphenyl)methyl]phenyl]-6-methyloxan-4-ol |
| SMILES | COc1ccc(Cc2cccc([C@H]3C[C@@H](O)C[C@@H](C)O3)c2)cc1 |
| InChI | InChI=1S/C20H24O3/c1-14-10-18(21)13-20(23-14)17-5-3-4-16(12-17)11-15-6-8-19(22-2)9-7-15/h3-9,12,14,18,20-21H,10-11,13H2,1-2H3/t14-,18+,20-/m1/s1 |
| InChIKey | QMCLXGRVHHKTEH-HEFCMCLBSA-N |
| XLogP | 3.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |